C17H24N2O — CID 170175224
(3E,4E)-4-[1-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]prop-2-enylidene]-3-propylidenepiperidin-2-one (PubChem CID 170175224) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (3E,4E)-4-[1-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]prop-2-enylidene]-3-propylidenepiperidin-2-one.
| Compound Name | (3E,4E)-4-[1-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]prop-2-enylidene]-3-propylidenepiperidin-2-one |
|---|---|
| PubChem CID | 170175224 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (3E,4E)-4-[1-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]prop-2-enylidene]-3-propylidenepiperidin-2-one |
| SMILES | C=C/C(NC(/C=C\C)=C/C)=C1/CCNC(=O)/C1=C/CC |
| InChI | InChI=1S/C17H24N2O/c1-5-9-13(7-3)19-16(8-4)14-11-12-18-17(20)15(14)10-6-2/h5,7-10,19H,4,6,11-12H2,1-3H3,(H,18,20)/b9-5-,13-7+,15-10+,16-14+ |
| InChIKey | IACPOQPLXMKXSK-AFTWMLMISA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|