C25H16F3NO3S — CID 170175259
(2E)-5-ethyl-6-methyl-2-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-d][1,3]thiazol-5-yl]methylidene]indene-1,3-dione (PubChem CID 170175259) has the molecular formula C25H16F3NO3S and a molecular weight of 467.47 g/mol. Its IUPAC name is (2E)-5-ethyl-6-methyl-2-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-d][1,3]thiazol-5-yl]methylidene]indene-1,3-dione.
| Compound Name | (2E)-5-ethyl-6-methyl-2-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-d][1,3]thiazol-5-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 170175259 |
| Molecular Formula | C25H16F3NO3S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (2E)-5-ethyl-6-methyl-2-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-d][1,3]thiazol-5-yl]methylidene]indene-1,3-dione |
| SMILES | CCc1cc2c(cc1C)C(=O)/C(=C\c1cc3sc(-c4ccc(C(F)(F)F)cc4)nc3o1)C2=O |
| InChI | InChI=1S/C25H16F3NO3S/c1-3-13-9-18-17(8-12(13)2)21(30)19(22(18)31)10-16-11-20-23(32-16)29-24(33-20)14-4-6-15(7-5-14)25(26,27)28/h4-11H,3H2,1-2H3/b19-10+ |
| InChIKey | INDFLRZRJMZARC-VXLYETTFSA-N |
| XLogP | 6.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|