C23H20FN9O — CID 170175430
3-[4-amino-6-[3-azido-3-[1-(oxolan-2-ylmethyl)pyrazol-3-yl]prop-1-ynyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile (PubChem CID 170175430) has the molecular formula C23H20FN9O and a molecular weight of 457.47 g/mol. Its IUPAC name is 3-[4-amino-6-[3-azido-3-[1-(oxolan-2-ylmethyl)pyrazol-3-yl]prop-1-ynyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[4-amino-6-[3-azido-3-[1-(oxolan-2-ylmethyl)pyrazol-3-yl]prop-1-ynyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 170175430 |
| Molecular Formula | C23H20FN9O |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-[4-amino-6-[3-azido-3-[1-(oxolan-2-ylmethyl)pyrazol-3-yl]prop-1-ynyl]-5-fluoropyrimidin-2-yl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1-c1nc(N)c(F)c(C#CC(N=[N+]=[N-])c2ccn(CC3CCCO3)n2)n1 |
| InChI | InChI=1S/C23H20FN9O/c1-14-15(12-25)4-2-6-17(14)23-28-20(21(24)22(26)29-23)8-7-18(30-32-27)19-9-10-33(31-19)13-16-5-3-11-34-16/h2,4,6,9-10,16,18H,3,5,11,13H2,1H3,(H2,26,28,29) |
| InChIKey | LCUMHWFZJNRJBC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|