C16H22F2N2 — CID 170175799
N-[(Z)-3-[4-[(1E,3E,5E)-1,3-difluorohepta-1,3,5-trienyl]piperidin-1-yl]prop-1-enyl]methanimine (PubChem CID 170175799) has the molecular formula C16H22F2N2 and a molecular weight of 280.36 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(1E,3E,5E)-1,3-difluorohepta-1,3,5-trienyl]piperidin-1-yl]prop-1-enyl]methanimine.
| Compound Name | N-[(Z)-3-[4-[(1E,3E,5E)-1,3-difluorohepta-1,3,5-trienyl]piperidin-1-yl]prop-1-enyl]methanimine |
|---|---|
| PubChem CID | 170175799 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-[(Z)-3-[4-[(1E,3E,5E)-1,3-difluorohepta-1,3,5-trienyl]piperidin-1-yl]prop-1-enyl]methanimine |
| SMILES | C=N/C=C\CN1CCC(/C(F)=C\C(F)=C/C=C/C)CC1 |
| InChI | InChI=1S/C16H22F2N2/c1-3-4-6-15(17)13-16(18)14-7-11-20(12-8-14)10-5-9-19-2/h3-6,9,13-14H,2,7-8,10-12H2,1H3/b4-3+,9-5-,15-6+,16-13+ |
| InChIKey | VDVZJFCIKRROEX-OCSUAALXSA-N |
| XLogP | 4.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|