C26H25F2N5O3 — CID 170175892
N-[5-cyano-2-[4-[(2Z,4E,6Z)-3,5-difluoroocta-2,4,6-trienoyl]piperazin-1-yl]phenyl]-2-methoxypyridine-3-carboxamide (PubChem CID 170175892) has the molecular formula C26H25F2N5O3 and a molecular weight of 493.51 g/mol. Its IUPAC name is N-[5-cyano-2-[4-[(2Z,4E,6Z)-3,5-difluoroocta-2,4,6-trienoyl]piperazin-1-yl]phenyl]-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[5-cyano-2-[4-[(2Z,4E,6Z)-3,5-difluoroocta-2,4,6-trienoyl]piperazin-1-yl]phenyl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 170175892 |
| Molecular Formula | C26H25F2N5O3 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[5-cyano-2-[4-[(2Z,4E,6Z)-3,5-difluoroocta-2,4,6-trienoyl]piperazin-1-yl]phenyl]-2-methoxypyridine-3-carboxamide |
| SMILES | C/C=C\C(F)=C/C(F)=C/C(=O)N1CCN(c2ccc(C#N)cc2NC(=O)c2cccnc2OC)CC1 |
| InChI | InChI=1S/C26H25F2N5O3/c1-3-5-19(27)15-20(28)16-24(34)33-12-10-32(11-13-33)23-8-7-18(17-29)14-22(23)31-25(35)21-6-4-9-30-26(21)36-2/h3-9,14-16H,10-13H2,1-2H3,(H,31,35)/b5-3-,19-15+,20-16- |
| InChIKey | MVJLXPGQZDNJNY-KZFXQGCESA-N |
| XLogP | 4.15 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|