C42H52N2 — CID 170176865
9-ethyl-3-(9-ethyl-1,2,4,5,6,7,8-heptamethylcarbazol-3-yl)-1,2,4,5,6,7,8-heptamethylcarbazole (PubChem CID 170176865) has the molecular formula C42H52N2 and a molecular weight of 584.89 g/mol. Its IUPAC name is 9-ethyl-3-(9-ethyl-1,2,4,5,6,7,8-heptamethylcarbazol-3-yl)-1,2,4,5,6,7,8-heptamethylcarbazole.
| Compound Name | 9-ethyl-3-(9-ethyl-1,2,4,5,6,7,8-heptamethylcarbazol-3-yl)-1,2,4,5,6,7,8-heptamethylcarbazole |
|---|---|
| PubChem CID | 170176865 |
| Molecular Formula | C42H52N2 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | 9-ethyl-3-(9-ethyl-1,2,4,5,6,7,8-heptamethylcarbazol-3-yl)-1,2,4,5,6,7,8-heptamethylcarbazole |
| SMILES | CCn1c2c(C)c(C)c(C)c(C)c2c2c(C)c(-c3c(C)c(C)c4c(c3C)c3c(C)c(C)c(C)c(C)c3n4CC)c(C)c(C)c21 |
| InChI | InChI=1S/C42H52N2/c1-17-43-39-27(11)21(5)19(3)23(7)35(39)37-31(15)33(25(9)29(13)41(37)43)34-26(10)30(14)42-38(32(34)16)36-24(8)20(4)22(6)28(12)40(36)44(42)18-2/h17-18H2,1-16H3 |
| InChIKey | DKDRZRXZWIYMGX-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |