C19H16F3N3O — CID 170178079
5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,4'-2,3-dihydro-1H-naphthalene]-7-one (PubChem CID 170178079) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,4'-2,3-dihydro-1H-naphthalene]-7-one.
| Compound Name | 5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,4'-2,3-dihydro-1H-naphthalene]-7-one |
|---|---|
| PubChem CID | 170178079 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,4'-2,3-dihydro-1H-naphthalene]-7-one |
| SMILES | C/N=C1\NC(=O)C2(CCCc3ccccc32)c2nc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H16F3N3O/c1-23-16-12-8-9-14(19(20,21)22)24-15(12)18(17(26)25-16)10-4-6-11-5-2-3-7-13(11)18/h2-3,5,7-9H,4,6,10H2,1H3,(H,23,25,26) |
| InChIKey | UYQFYSOVILRLFD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|