C20H18F3N3O — CID 170178119
1',1'-dimethyl-5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-indene]-7-one (PubChem CID 170178119) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is 1',1'-dimethyl-5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-indene]-7-one.
| Compound Name | 1',1'-dimethyl-5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-indene]-7-one |
|---|---|
| PubChem CID | 170178119 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1',1'-dimethyl-5-methylimino-2-(trifluoromethyl)spiro[1,6-naphthyridine-8,3'-2H-indene]-7-one |
| SMILES | C/N=C1\NC(=O)C2(CC(C)(C)c3ccccc32)c2nc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H18F3N3O/c1-18(2)10-19(13-7-5-4-6-12(13)18)15-11(16(24-3)26-17(19)27)8-9-14(25-15)20(21,22)23/h4-9H,10H2,1-3H3,(H,24,26,27) |
| InChIKey | CZJALEAWJBAIAW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|