About 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one
8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one (PubChem CID 170178121) has the molecular formula C17H14F3N3O
and a molecular weight of 333.31 g/mol. Its IUPAC name is 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one.
Molecular Properties
| Compound Name | 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one |
| PubChem CID | 170178121 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one |
| SMILES | C/N=C1\NC(=O)C(C)(c2ccccc2)c2nc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H14F3N3O/c1-16(10-6-4-3-5-7-10)13-11(14(21-2)23-15(16)24)8-9-12(22-13)17(18,19)20/h3-9H,1-2H3,(H,21,23,24) |
| InChIKey | UJHMTLYQBFVWDT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one?
The IUPAC name of 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one (CID 170178121) is 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one.
What is the SMILES notation for 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one?
The canonical SMILES for 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one is C/N=C1\NC(=O)C(C)(c2ccccc2)c2nc(C(F)(F)F)ccc21.
What is the InChIKey of 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one?
The InChIKey is UJHMTLYQBFVWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N3O/c1-16(10-6-4-3-5-7-10)13-11(14(21-2)23-15(16)24)8-9-12(22-13)17(18,19)20/h3-9H,1-2H3,(H,21,23,24).
What are the key properties of 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one?
8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one has a molecular weight of 333.31 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5-methylimino-8-phenyl-2-(trifluoromethyl)-1,6-naphthyridin-7-one is sourced from PubChem (CID 170178121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).