C19H14F5N3O — CID 170178187
1'-methylimino-6'-(1,1,2,2,2-pentafluoroethyl)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one (PubChem CID 170178187) has the molecular formula C19H14F5N3O and a molecular weight of 395.33 g/mol. Its IUPAC name is 1'-methylimino-6'-(1,1,2,2,2-pentafluoroethyl)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one.
| Compound Name | 1'-methylimino-6'-(1,1,2,2,2-pentafluoroethyl)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one |
|---|---|
| PubChem CID | 170178187 |
| Molecular Formula | C19H14F5N3O |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1'-methylimino-6'-(1,1,2,2,2-pentafluoroethyl)spiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one |
| SMILES | C/N=C1\NC(=O)C2(CCc3ncccc32)c2cc(C(F)(F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H14F5N3O/c1-25-15-11-5-4-10(18(20,21)19(22,23)24)9-13(11)17(16(28)27-15)7-6-14-12(17)3-2-8-26-14/h2-5,8-9H,6-7H2,1H3,(H,25,27,28) |
| InChIKey | NQHOUKMPKIMJJD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|