C20H17NO3 — CID 170178428
6'-cyclopropylspiro[2,3-dihydrochromene-4,4'-isoquinoline]-1',3'-dione (PubChem CID 170178428) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 6'-cyclopropylspiro[2,3-dihydrochromene-4,4'-isoquinoline]-1',3'-dione.
| Compound Name | 6'-cyclopropylspiro[2,3-dihydrochromene-4,4'-isoquinoline]-1',3'-dione |
|---|---|
| PubChem CID | 170178428 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6'-cyclopropylspiro[2,3-dihydrochromene-4,4'-isoquinoline]-1',3'-dione |
| SMILES | O=C1NC(=O)C2(CCOc3ccccc32)c2cc(C3CC3)ccc21 |
| InChI | InChI=1S/C20H17NO3/c22-18-14-8-7-13(12-5-6-12)11-16(14)20(19(23)21-18)9-10-24-17-4-2-1-3-15(17)20/h1-4,7-8,11-12H,5-6,9-10H2,(H,21,22,23) |
| InChIKey | VVANTDOQNSKNBX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|