C18H14F3N3O — CID 170178503
5'-methylimino-2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one (PubChem CID 170178503) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 5'-methylimino-2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one.
| Compound Name | 5'-methylimino-2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one |
|---|---|
| PubChem CID | 170178503 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 5'-methylimino-2'-(trifluoromethyl)spiro[1,2-dihydroindene-3,8'-1,6-naphthyridine]-7'-one |
| SMILES | C/N=C1\NC(=O)C2(CCc3ccccc32)c2nc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H14F3N3O/c1-22-15-11-6-7-13(18(19,20)21)23-14(11)17(16(25)24-15)9-8-10-4-2-3-5-12(10)17/h2-7H,8-9H2,1H3,(H,22,24,25) |
| InChIKey | MUYPSFZAYLARDO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|