C21H22F3N3O — CID 170178506
N-[[2-(2-phenylethyl)-6-(trifluoromethyl)-3-pyridinyl]-pyrrolidin-1-ylmethylidene]acetamide (PubChem CID 170178506) has the molecular formula C21H22F3N3O and a molecular weight of 389.42 g/mol. Its IUPAC name is N-[[2-(2-phenylethyl)-6-(trifluoromethyl)-3-pyridinyl]-pyrrolidin-1-ylmethylidene]acetamide.
| Compound Name | N-[[2-(2-phenylethyl)-6-(trifluoromethyl)-3-pyridinyl]-pyrrolidin-1-ylmethylidene]acetamide |
|---|---|
| PubChem CID | 170178506 |
| Molecular Formula | C21H22F3N3O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[[2-(2-phenylethyl)-6-(trifluoromethyl)-3-pyridinyl]-pyrrolidin-1-ylmethylidene]acetamide |
| SMILES | CC(=O)/N=C(/c1ccc(C(F)(F)F)nc1CCc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C21H22F3N3O/c1-15(28)25-20(27-13-5-6-14-27)17-10-12-19(21(22,23)24)26-18(17)11-9-16-7-3-2-4-8-16/h2-4,7-8,10,12H,5-6,9,11,13-14H2,1H3/b25-20- |
| InChIKey | RIMCUCXWVGJNCW-QQTULTPQSA-N |
| XLogP | 4.27 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|