C24H30F2N6O3S — CID 170178554
N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-6-(3,3-difluoroazetidin-1-yl)-5-methoxypyridine-2-carboxamide (PubChem CID 170178554) has the molecular formula C24H30F2N6O3S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-6-(3,3-difluoroazetidin-1-yl)-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-6-(3,3-difluoroazetidin-1-yl)-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 170178554 |
| Molecular Formula | C24H30F2N6O3S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-[4-(6-azaspiro[2.5]octan-6-yl)-6-(2-hydroxyethylamino)sulfanyl-3-pyridinyl]-6-(3,3-difluoroazetidin-1-yl)-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cnc(SNCCO)cc2N2CCC3(CC2)CC3)nc1N1CC(F)(F)C1 |
| InChI | InChI=1S/C24H30F2N6O3S/c1-35-19-3-2-16(29-21(19)32-14-24(25,26)15-32)22(34)30-17-13-27-20(36-28-8-11-33)12-18(17)31-9-6-23(4-5-23)7-10-31/h2-3,12-13,28,33H,4-11,14-15H2,1H3,(H,30,34) |
| InChIKey | DNRLZSBYJJTUMV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|