C17H13BrFN3O — CID 170178594
6'-bromo-8'-fluoro-1'-methyliminospiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one (PubChem CID 170178594) has the molecular formula C17H13BrFN3O and a molecular weight of 374.21 g/mol. Its IUPAC name is 6'-bromo-8'-fluoro-1'-methyliminospiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one.
| Compound Name | 6'-bromo-8'-fluoro-1'-methyliminospiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one |
|---|---|
| PubChem CID | 170178594 |
| Molecular Formula | C17H13BrFN3O |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 6'-bromo-8'-fluoro-1'-methyliminospiro[6,7-dihydrocyclopenta[b]pyridine-5,4'-isoquinoline]-3'-one |
| SMILES | C/N=C1\NC(=O)C2(CCc3ncccc32)c2cc(Br)cc(F)c21 |
| InChI | InChI=1S/C17H13BrFN3O/c1-20-15-14-11(7-9(18)8-12(14)19)17(16(23)22-15)5-4-13-10(17)3-2-6-21-13/h2-3,6-8H,4-5H2,1H3,(H,20,22,23) |
| InChIKey | CGYPJYXCGHPRGF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|