C25H30F3N5O3S — CID 170178617
2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3,3-difluoroazetidin-1-yl)-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide (PubChem CID 170178617) has the molecular formula C25H30F3N5O3S and a molecular weight of 537.61 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3,3-difluoroazetidin-1-yl)-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3,3-difluoroazetidin-1-yl)-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 170178617 |
| Molecular Formula | C25H30F3N5O3S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3,3-difluoroazetidin-1-yl)-5-(fluoromethoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
| SMILES | O=C(Nc1ccc(OCF)c(N2CC(F)(F)C2)n1)c1ccc(SNCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C25H30F3N5O3S/c26-16-36-20-3-4-21(30-22(20)33-14-25(27,28)15-33)31-23(35)18-2-1-17(37-29-9-12-34)13-19(18)32-10-7-24(5-6-24)8-11-32/h1-4,13,29,34H,5-12,14-16H2,(H,30,31,35) |
| InChIKey | YGSAUDSBHKBWKL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|