C25H30F4N4O4S — CID 170178618
2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-(3,3,3-trifluoropropoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide (PubChem CID 170178618) has the molecular formula C25H30F4N4O4S and a molecular weight of 558.60 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-(3,3,3-trifluoropropoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-(3,3,3-trifluoropropoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 170178618 |
| Molecular Formula | C25H30F4N4O4S |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[5-(fluoromethoxy)-6-(3,3,3-trifluoropropoxy)-2-pyridinyl]-4-(2-hydroxyethylamino)sulfanylbenzamide |
| SMILES | O=C(Nc1ccc(OCF)c(OCCC(F)(F)F)n1)c1ccc(SNCCO)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C25H30F4N4O4S/c26-16-37-20-3-4-21(32-23(20)36-14-9-25(27,28)29)31-22(35)18-2-1-17(38-30-10-13-34)15-19(18)33-11-7-24(5-6-24)8-12-33/h1-4,15,30,34H,5-14,16H2,(H,31,32,35) |
| InChIKey | VITUUNIQRLIWOG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|