About (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide
(2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide (PubChem CID 170178765) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide |
| PubChem CID | 170178765 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide |
| SMILES | C=C(F)/C=C(CC)/C(N)=N/C |
| InChI | InChI=1S/C8H13FN2/c1-4-7(5-6(2)9)8(10)11-3/h5H,2,4H2,1,3H3,(H2,10,11)/b7-5+ |
| InChIKey | OKCKOXLVVKNFTR-FNORWQNLSA-N |
| XLogP | 1.79 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide?
The IUPAC name of (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide (CID 170178765) is (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide.
What is the SMILES notation for (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide?
The canonical SMILES for (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide is C=C(F)/C=C(CC)/C(N)=N/C.
What is the InChIKey of (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide?
The InChIKey is OKCKOXLVVKNFTR-FNORWQNLSA-N. The full InChI is InChI=1S/C8H13FN2/c1-4-7(5-6(2)9)8(10)11-3/h5H,2,4H2,1,3H3,(H2,10,11)/b7-5+.
What are the key properties of (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide?
(2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide has a molecular weight of 156.20 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethyl-4-fluoro-N'-methylpenta-2,4-dienimidamide is sourced from PubChem (CID 170178765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).