C30H39F2N5O4S — CID 170178774
2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl propanoate (PubChem CID 170178774) has the molecular formula C30H39F2N5O4S and a molecular weight of 603.74 g/mol. Its IUPAC name is 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl propanoate.
| Compound Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl propanoate |
|---|---|
| PubChem CID | 170178774 |
| Molecular Formula | C30H39F2N5O4S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl propanoate |
| SMILES | CCC(=O)OCCNSc1ccc(C(=O)Nc2ccc(OC)c(N3CCC(F)(F)CC3)n2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C30H39F2N5O4S/c1-3-26(38)41-19-14-33-42-21-4-5-22(23(20-21)36-15-10-29(8-9-29)11-16-36)28(39)35-25-7-6-24(40-2)27(34-25)37-17-12-30(31,32)13-18-37/h4-7,20,33H,3,8-19H2,1-2H3,(H,34,35,39) |
| InChIKey | GZZCJVWUVGXVSP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|