C31H41F2N5O4S — CID 170178776
2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl butanoate (PubChem CID 170178776) has the molecular formula C31H41F2N5O4S and a molecular weight of 617.76 g/mol. Its IUPAC name is 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl butanoate.
| Compound Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl butanoate |
|---|---|
| PubChem CID | 170178776 |
| Molecular Formula | C31H41F2N5O4S |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl butanoate |
| SMILES | CCCC(=O)OCCNSc1ccc(NC(=O)c2ccc(OC)c(N3CCC(F)(F)CC3)n2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C31H41F2N5O4S/c1-3-4-27(39)42-20-15-34-43-22-5-6-23(25(21-22)37-16-11-30(9-10-30)12-17-37)36-29(40)24-7-8-26(41-2)28(35-24)38-18-13-31(32,33)14-19-38/h5-8,21,34H,3-4,9-20H2,1-2H3,(H,36,40) |
| InChIKey | HEWIQEFPBRINKO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|