C30H37F2N5O4S — CID 170178778
2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]anilino]sulfanylethyl prop-2-enoate (PubChem CID 170178778) has the molecular formula C30H37F2N5O4S and a molecular weight of 601.72 g/mol. Its IUPAC name is 2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]anilino]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]anilino]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 170178778 |
| Molecular Formula | C30H37F2N5O4S |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 2-[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]anilino]sulfanylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSNc1ccc(NC(=O)c2ccc(OC)c(N3CCC(F)(F)CC3)n2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C30H37F2N5O4S/c1-3-26(38)41-18-19-42-35-21-4-5-22(24(20-21)36-14-10-29(8-9-29)11-15-36)34-28(39)23-6-7-25(40-2)27(33-23)37-16-12-30(31,32)13-17-37/h3-7,20,35H,1,8-19H2,2H3,(H,34,39) |
| InChIKey | JLDJAQVVFQBAEI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|