C31H42F2N6O4S — CID 170178786
2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl (2R)-2-aminobutanoate (PubChem CID 170178786) has the molecular formula C31H42F2N6O4S and a molecular weight of 632.78 g/mol. Its IUPAC name is 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl (2R)-2-aminobutanoate.
| Compound Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl (2R)-2-aminobutanoate |
|---|---|
| PubChem CID | 170178786 |
| Molecular Formula | C31H42F2N6O4S |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxy-2-pyridinyl]carbamoyl]phenyl]sulfanylamino]ethyl (2R)-2-aminobutanoate |
| SMILES | CC[C@@H](N)C(=O)OCCNSc1ccc(C(=O)Nc2ccc(OC)c(N3CCC(F)(F)CC3)n2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C31H42F2N6O4S/c1-3-23(34)29(41)43-19-14-35-44-21-4-5-22(24(20-21)38-15-10-30(8-9-30)11-16-38)28(40)37-26-7-6-25(42-2)27(36-26)39-17-12-31(32,33)13-18-39/h4-7,20,23,35H,3,8-19,34H2,1-2H3,(H,36,37,40)/t23-/m1/s1 |
| InChIKey | LPEXELUPAUBNST-HSZRJFAPSA-N |
| XLogP | 4.84 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|