About 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene
1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene (PubChem CID 170179066) has the molecular formula C12H21F
and a molecular weight of 184.30 g/mol. Its IUPAC name is 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene |
| PubChem CID | 170179066 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene |
| SMILES | CC1=C(C(C)(C)C)CCC(C)(F)C1 |
| InChI | InChI=1S/C12H21F/c1-9-8-12(5,13)7-6-10(9)11(2,3)4/h6-8H2,1-5H3 |
| InChIKey | LOSGUPXEALLTBX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene?
The IUPAC name of 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene (CID 170179066) is 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene.
What is the SMILES notation for 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene?
The canonical SMILES for 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene is CC1=C(C(C)(C)C)CCC(C)(F)C1.
What is the InChIKey of 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene?
The InChIKey is LOSGUPXEALLTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F/c1-9-8-12(5,13)7-6-10(9)11(2,3)4/h6-8H2,1-5H3.
What are the key properties of 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene?
1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene has a molecular weight of 184.30 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-fluoro-2,4-dimethylcyclohexene is sourced from PubChem (CID 170179066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).