C16H29N3 — CID 170179510
N'-[(2Z,4Z)-3-(1-aminoethenyl)-6-ethyl-4,7-dimethylocta-2,4-dien-2-yl]ethanimidamide (PubChem CID 170179510) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N'-[(2Z,4Z)-3-(1-aminoethenyl)-6-ethyl-4,7-dimethylocta-2,4-dien-2-yl]ethanimidamide.
| Compound Name | N'-[(2Z,4Z)-3-(1-aminoethenyl)-6-ethyl-4,7-dimethylocta-2,4-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 170179510 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N'-[(2Z,4Z)-3-(1-aminoethenyl)-6-ethyl-4,7-dimethylocta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C(N)C(/C(C)=C\C(CC)C(C)C)=C(C)\N=C(/C)N |
| InChI | InChI=1S/C16H29N3/c1-8-15(10(2)3)9-11(4)16(12(5)17)13(6)19-14(7)18/h9-10,15H,5,8,17H2,1-4,6-7H3,(H2,18,19)/b11-9-,16-13- |
| InChIKey | RAOPBLFDFCMMQE-SQHGXFKPSA-N |
| XLogP | 3.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|