C18H32N2 — CID 170179562
(Z,3Z)-6-ethyl-3-[1-(ethylideneamino)ethylidene]-4,9-dimethyldec-4-en-2-imine (PubChem CID 170179562) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (Z,3Z)-6-ethyl-3-[1-(ethylideneamino)ethylidene]-4,9-dimethyldec-4-en-2-imine.
| Compound Name | (Z,3Z)-6-ethyl-3-[1-(ethylideneamino)ethylidene]-4,9-dimethyldec-4-en-2-imine |
|---|---|
| PubChem CID | 170179562 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | (Z,3Z)-6-ethyl-3-[1-(ethylideneamino)ethylidene]-4,9-dimethyldec-4-en-2-imine |
| SMILES | [H]/N=C(C)/C(C(/C)=C\C(CC)CCC(C)C)=C(C)\N=C\C |
| InChI | InChI=1S/C18H32N2/c1-8-17(11-10-13(3)4)12-14(5)18(15(6)19)16(7)20-9-2/h9,12-13,17,19H,8,10-11H2,1-7H3/b14-12-,18-16-,19-15+,20-9+ |
| InChIKey | PQTRGJAWBZDPAS-MWZSTYHQSA-N |
| XLogP | 5.80 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|