About 4-cyclobutyl-N,N-dimethylaniline
4-cyclobutyl-N,N-dimethylaniline (PubChem CID 170179749) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-cyclobutyl-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-cyclobutyl-N,N-dimethylaniline |
| PubChem CID | 170179749 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-cyclobutyl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C12H17N/c1-13(2)12-8-6-11(7-9-12)10-4-3-5-10/h6-10H,3-5H2,1-2H3 |
| InChIKey | HPJGXCOLMSMHMP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclobutyl-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyl-N,N-dimethylaniline?
The IUPAC name of 4-cyclobutyl-N,N-dimethylaniline (CID 170179749) is 4-cyclobutyl-N,N-dimethylaniline.
What is the SMILES notation for 4-cyclobutyl-N,N-dimethylaniline?
The canonical SMILES for 4-cyclobutyl-N,N-dimethylaniline is CN(C)c1ccc(C2CCC2)cc1.
What is the InChIKey of 4-cyclobutyl-N,N-dimethylaniline?
The InChIKey is HPJGXCOLMSMHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-13(2)12-8-6-11(7-9-12)10-4-3-5-10/h6-10H,3-5H2,1-2H3.
What are the key properties of 4-cyclobutyl-N,N-dimethylaniline?
4-cyclobutyl-N,N-dimethylaniline has a molecular weight of 175.27 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyl-N,N-dimethylaniline is sourced from PubChem (CID 170179749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).