C63H51N — CID 170179873
N,N-bis(9,9-dimethyl-5-phenylfluoren-2-yl)-9,9-dimethyl-5-phenylfluoren-2-amine (PubChem CID 170179873) has the molecular formula C63H51N and a molecular weight of 822.11 g/mol. Its IUPAC name is N,N-bis(9,9-dimethyl-5-phenylfluoren-2-yl)-9,9-dimethyl-5-phenylfluoren-2-amine.
| Compound Name | N,N-bis(9,9-dimethyl-5-phenylfluoren-2-yl)-9,9-dimethyl-5-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 170179873 |
| Molecular Formula | C63H51N |
| Molecular Weight | 822.11 g/mol |
| Exact Mass | 821.40 |
| IUPAC Name | N,N-bis(9,9-dimethyl-5-phenylfluoren-2-yl)-9,9-dimethyl-5-phenylfluoren-2-amine |
| SMILES | CC1(C)c2cc(N(c3ccc4c(c3)C(C)(C)c3cccc(-c5ccccc5)c3-4)c3ccc4c(c3)C(C)(C)c3cccc(-c5ccccc5)c3-4)ccc2-c2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C63H51N/c1-61(2)52-28-16-25-46(40-19-10-7-11-20-40)58(52)49-34-31-43(37-55(49)61)64(44-32-35-50-56(38-44)62(3,4)53-29-17-26-47(59(50)53)41-21-12-8-13-22-41)45-33-36-51-57(39-45)63(5,6)54-30-18-27-48(60(51)54)42-23-14-9-15-24-42/h7-39H,1-6H3 |
| InChIKey | QATKHQVJUJUKJE-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.11 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |