C21H17N3O — CID 170179957
(2E)-6-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-4,9-dihydro-3H-carbazol-1-one (PubChem CID 170179957) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is (2E)-6-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-4,9-dihydro-3H-carbazol-1-one.
| Compound Name | (2E)-6-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-4,9-dihydro-3H-carbazol-1-one |
|---|---|
| PubChem CID | 170179957 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2E)-6-methyl-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-4,9-dihydro-3H-carbazol-1-one |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC/C(=C\c1c[nH]c2ncccc12)C3=O |
| InChI | InChI=1S/C21H17N3O/c1-12-4-7-18-17(9-12)16-6-5-13(20(25)19(16)24-18)10-14-11-23-21-15(14)3-2-8-22-21/h2-4,7-11,24H,5-6H2,1H3,(H,22,23)/b13-10+ |
| InChIKey | IKMGANWAXYKSMB-JLHYYAGUSA-N |
| XLogP | 4.57 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|