C23H38N2O2 — CID 170180213
(1S,2R,8R,11S,12S,15S,16S)-N-tert-butyl-2,16-dimethyl-4-oxa-7-azapentacyclo[9.7.0.02,8.03,5.012,16]octadecane-15-carboxamide (PubChem CID 170180213) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is (1S,2R,8R,11S,12S,15S,16S)-N-tert-butyl-2,16-dimethyl-4-oxa-7-azapentacyclo[9.7.0.02,8.03,5.012,16]octadecane-15-carboxamide.
| Compound Name | (1S,2R,8R,11S,12S,15S,16S)-N-tert-butyl-2,16-dimethyl-4-oxa-7-azapentacyclo[9.7.0.02,8.03,5.012,16]octadecane-15-carboxamide |
|---|---|
| PubChem CID | 170180213 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (1S,2R,8R,11S,12S,15S,16S)-N-tert-butyl-2,16-dimethyl-4-oxa-7-azapentacyclo[9.7.0.02,8.03,5.012,16]octadecane-15-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4NCC5OC5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H38N2O2/c1-21(2,3)25-20(26)16-8-7-14-13-6-9-18-23(5,19-17(27-19)12-24-18)15(13)10-11-22(14,16)4/h13-19,24H,6-12H2,1-5H3,(H,25,26)/t13-,14-,15-,16+,17?,18+,19?,22-,23+/m0/s1 |
| InChIKey | YGVMTWNOBLUCSW-ZERIOGKYSA-N |
| XLogP | 3.50 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|