C30H50N5O8P — CID 170180438
[6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl] [3-propoxy-2,2-bis(propoxymethyl)propyl] hydrogen phosphate (PubChem CID 170180438) has the molecular formula C30H50N5O8P and a molecular weight of 639.73 g/mol. Its IUPAC name is [6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl] [3-propoxy-2,2-bis(propoxymethyl)propyl] hydrogen phosphate.
| Compound Name | [6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl] [3-propoxy-2,2-bis(propoxymethyl)propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 170180438 |
| Molecular Formula | C30H50N5O8P |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 639.34 |
| IUPAC Name | [6-[[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methylamino]-6-oxohexyl] [3-propoxy-2,2-bis(propoxymethyl)propyl] hydrogen phosphate |
| SMILES | CCCOCC(COCCC)(COCCC)COP(=O)(O)OCCCCCC(=O)NCc1ccc(-c2nnc(C)nn2)cc1 |
| InChI | InChI=1S/C30H50N5O8P/c1-5-16-39-21-30(22-40-17-6-2,23-41-18-7-3)24-43-44(37,38)42-19-10-8-9-11-28(36)31-20-26-12-14-27(15-13-26)29-34-32-25(4)33-35-29/h12-15H,5-11,16-24H2,1-4H3,(H,31,36)(H,37,38) |
| InChIKey | LZWBAAZCMWPUBD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|