C24H31N5O4S — CID 170180988
N-[(2S)-1-[(2S,4R)-4-hydroxy-2-[5-methyl-5-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]formamide (PubChem CID 170180988) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is N-[(2S)-1-[(2S,4R)-4-hydroxy-2-[5-methyl-5-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]formamide.
| Compound Name | N-[(2S)-1-[(2S,4R)-4-hydroxy-2-[5-methyl-5-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]formamide |
|---|---|
| PubChem CID | 170180988 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[(2S)-1-[(2S,4R)-4-hydroxy-2-[5-methyl-5-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]-2H-1,2,4-oxadiazol-3-yl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]formamide |
| SMILES | Cc1ncsc1-c1ccc(C2(C)N=C([C@@H]3C[C@@H](O)CN3C(=O)[C@@H](NC=O)C(C)(C)C)NO2)cc1 |
| InChI | InChI=1S/C24H31N5O4S/c1-14-19(34-13-26-14)15-6-8-16(9-7-15)24(5)27-21(28-33-24)18-10-17(31)11-29(18)22(32)20(25-12-30)23(2,3)4/h6-9,12-13,17-18,20,31H,10-11H2,1-5H3,(H,25,30)(H,27,28)/t17-,18+,20-,24?/m1/s1 |
| InChIKey | VAWMUHIOYLHIQO-CXFIUDIKSA-N |
| XLogP | 2.35 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|