C20H29NO2 — CID 170181479
methyl (2E,4E)-5-[[(4Z,5Z)-4,5-di(ethylidene)azepan-1-yl]methyl]-2-methylhepta-2,4,6-trienoate (PubChem CID 170181479) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is methyl (2E,4E)-5-[[(4Z,5Z)-4,5-di(ethylidene)azepan-1-yl]methyl]-2-methylhepta-2,4,6-trienoate.
| Compound Name | methyl (2E,4E)-5-[[(4Z,5Z)-4,5-di(ethylidene)azepan-1-yl]methyl]-2-methylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 170181479 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | methyl (2E,4E)-5-[[(4Z,5Z)-4,5-di(ethylidene)azepan-1-yl]methyl]-2-methylhepta-2,4,6-trienoate |
| SMILES | C=C/C(=C\C=C(/C)C(=O)OC)CN1CCC(=C/C)/C(=C\C)CC1 |
| InChI | InChI=1S/C20H29NO2/c1-6-17(10-9-16(4)20(22)23-5)15-21-13-11-18(7-2)19(8-3)12-14-21/h6-10H,1,11-15H2,2-5H3/b16-9+,17-10+,18-7-,19-8- |
| InChIKey | RJBLRKKEUBHDEB-AYWQTXPCSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|