C27H29Cl2FN6O2 — CID 170181532
2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)-3-fluorophenyl]-2-iminoacetamide (PubChem CID 170181532) has the molecular formula C27H29Cl2FN6O2 and a molecular weight of 559.47 g/mol. Its IUPAC name is 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)-3-fluorophenyl]-2-iminoacetamide.
| Compound Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)-3-fluorophenyl]-2-iminoacetamide |
|---|---|
| PubChem CID | 170181532 |
| Molecular Formula | C27H29Cl2FN6O2 |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-(3,5-dimethylpiperazin-1-yl)-3-fluorophenyl]-2-iminoacetamide |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(N2CC(C)NC(C)C2)c(F)c1)c1cc(OC(C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C27H29Cl2FN6O2/c1-14-12-36(13-15(2)34-14)24-7-4-17(8-22(24)30)35-27(37)26(32)19-9-18(5-6-23(19)31)38-16(3)25-20(28)10-33-11-21(25)29/h4-11,14-16,32,34H,12-13,31H2,1-3H3,(H,35,37)/b32-26- |
| InChIKey | PVWFBJKDHFKZJZ-FSRJSHLRSA-N |
| XLogP | 5.44 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|