C21H20N8O — CID 170182723
6-[(1E)-1-aminobuta-1,3-dien-2-yl]-4-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrazine-3-carbonitrile (PubChem CID 170182723) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is 6-[(1E)-1-aminobuta-1,3-dien-2-yl]-4-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrazine-3-carbonitrile.
| Compound Name | 6-[(1E)-1-aminobuta-1,3-dien-2-yl]-4-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrazine-3-carbonitrile |
|---|---|
| PubChem CID | 170182723 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 6-[(1E)-1-aminobuta-1,3-dien-2-yl]-4-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrazine-3-carbonitrile |
| SMILES | C=C/C(=C\N)c1cn2ncc(C#N)c2c(-c2ccc(N3CCN(C=O)CC3)nc2)n1 |
| InChI | InChI=1S/C21H20N8O/c1-2-15(9-22)18-13-29-21(17(10-23)12-25-29)20(26-18)16-3-4-19(24-11-16)28-7-5-27(14-30)6-8-28/h2-4,9,11-14H,1,5-8,22H2/b15-9+ |
| InChIKey | WADFUSNRAGZNGI-OQLLNIDSSA-N |
| XLogP | 1.43 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|