C49H32N4O — CID 170183186
4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(4-phenylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-amine (PubChem CID 170183186) has the molecular formula C49H32N4O and a molecular weight of 692.82 g/mol. Its IUPAC name is 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(4-phenylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-amine.
| Compound Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(4-phenylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-amine |
|---|---|
| PubChem CID | 170183186 |
| Molecular Formula | C49H32N4O |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-phenyl-N-(4-phenylphenyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-12-amine |
| SMILES | c1ccc(-c2ccc(N(c3ccccc3)c3ccc4c5c(cccc35)-c3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3O4)cc2)cc1 |
| InChI | InChI=1S/C49H32N4O/c1-5-14-33(15-6-1)34-24-27-39(28-25-34)53(38-20-11-4-12-21-38)43-29-31-45-46-40(22-13-23-41(43)46)42-32-37(26-30-44(42)54-45)49-51-47(35-16-7-2-8-17-35)50-48(52-49)36-18-9-3-10-19-36/h1-32H |
| InChIKey | PBHSYUVABZJLRT-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |