C43H27N3S — CID 170183330
2,4-diphenyl-6-[12-(3-phenylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-6-yl]-1,3,5-triazine (PubChem CID 170183330) has the molecular formula C43H27N3S and a molecular weight of 617.78 g/mol. Its IUPAC name is 2,4-diphenyl-6-[12-(3-phenylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-6-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[12-(3-phenylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-6-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 170183330 |
| Molecular Formula | C43H27N3S |
| Molecular Weight | 617.78 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 2,4-diphenyl-6-[12-(3-phenylphenyl)-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-6-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3ccc4c5c(cccc35)-c3cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c3S4)c2)cc1 |
| InChI | InChI=1S/C43H27N3S/c1-4-13-28(14-5-1)31-19-10-20-32(27-31)33-25-26-38-39-34(33)21-11-22-35(39)36-23-12-24-37(40(36)47-38)43-45-41(29-15-6-2-7-16-29)44-42(46-43)30-17-8-3-9-18-30/h1-27H |
| InChIKey | GMLSMQVZSUXQFY-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.78 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |