C24H32N8OS — CID 170183993
(4S)-2-amino-3-cyano-4-methyl-N-[2-[(2S)-2,5,5-trimethyl-1,4-diazepan-1-yl]pyrimidine-4-carboximidoyl]-6,7-dihydro-5H-1-benzothiophene-4-carboxamide (PubChem CID 170183993) has the molecular formula C24H32N8OS and a molecular weight of 480.64 g/mol. Its IUPAC name is (4S)-2-amino-3-cyano-4-methyl-N-[2-[(2S)-2,5,5-trimethyl-1,4-diazepan-1-yl]pyrimidine-4-carboximidoyl]-6,7-dihydro-5H-1-benzothiophene-4-carboxamide.
| Compound Name | (4S)-2-amino-3-cyano-4-methyl-N-[2-[(2S)-2,5,5-trimethyl-1,4-diazepan-1-yl]pyrimidine-4-carboximidoyl]-6,7-dihydro-5H-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 170183993 |
| Molecular Formula | C24H32N8OS |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (4S)-2-amino-3-cyano-4-methyl-N-[2-[(2S)-2,5,5-trimethyl-1,4-diazepan-1-yl]pyrimidine-4-carboximidoyl]-6,7-dihydro-5H-1-benzothiophene-4-carboxamide |
| SMILES | [H]/N=C(/NC(=O)[C@@]1(C)CCCc2sc(N)c(C#N)c21)c1ccnc(N2CCC(C)(C)NC[C@@H]2C)n1 |
| InChI | InChI=1S/C24H32N8OS/c1-14-13-29-23(2,3)9-11-32(14)22-28-10-7-16(30-22)19(26)31-21(33)24(4)8-5-6-17-18(24)15(12-25)20(27)34-17/h7,10,14,29H,5-6,8-9,11,13,27H2,1-4H3,(H2,26,31,33)/t14-,24-/m0/s1 |
| InChIKey | CLLAMJLXTYRUCS-BSEYFRJRSA-N |
| XLogP | 2.69 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|