About N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide
N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide (PubChem CID 170184149) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide |
| PubChem CID | 170184149 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)Cc1cc2c(n1C)=CCCC=2 |
| InChI | InChI=1S/C14H18N2O/c1-4-14(17)15(2)10-12-9-11-7-5-6-8-13(11)16(12)3/h4,7-9H,1,5-6,10H2,2-3H3 |
| InChIKey | OBXPALLTICRXTA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide?
The IUPAC name of N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide (CID 170184149) is N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide.
What is the SMILES notation for N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide?
The canonical SMILES for N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide is C=CC(=O)N(C)Cc1cc2c(n1C)=CCCC=2.
What is the InChIKey of N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide?
The InChIKey is OBXPALLTICRXTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-4-14(17)15(2)10-12-9-11-7-5-6-8-13(11)16(12)3/h4,7-9H,1,5-6,10H2,2-3H3.
What are the key properties of N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide?
N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide has a molecular weight of 230.31 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(1-methyl-5,6-dihydroindol-2-yl)methyl]prop-2-enamide is sourced from PubChem (CID 170184149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).