About (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine
(1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine (PubChem CID 170184304) has the molecular formula C12H15N2OS+
and a molecular weight of 235.33 g/mol. Its IUPAC name is (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine.
Molecular Properties
| Compound Name | (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine |
| PubChem CID | 170184304 |
| Molecular Formula | C12H15N2OS+ |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine |
| SMILES | CC[N@+]1(C)c2c(sc3ccccc23)OC1N |
| InChI | InChI=1S/C12H15N2OS/c1-3-14(2)10-8-6-4-5-7-9(8)16-11(10)15-12(14)13/h4-7,12H,3,13H2,1-2H3/q+1/t12?,14-/m1/s1 |
| InChIKey | SRNNRVMIENWDOQ-TYZXPVIJSA-N |
| XLogP | 2.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine?
The IUPAC name of (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine (CID 170184304) is (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine.
What is the SMILES notation for (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine?
The canonical SMILES for (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine is CC[N@+]1(C)c2c(sc3ccccc23)OC1N.
What is the InChIKey of (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine?
The InChIKey is SRNNRVMIENWDOQ-TYZXPVIJSA-N. The full InChI is InChI=1S/C12H15N2OS/c1-3-14(2)10-8-6-4-5-7-9(8)16-11(10)15-12(14)13/h4-7,12H,3,13H2,1-2H3/q+1/t12?,14-/m1/s1.
What are the key properties of (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine?
(1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine has a molecular weight of 235.33 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-ethyl-1-methyl-2H-[1]benzothiolo[3,2-d][1,3]oxazol-1-ium-2-amine is sourced from PubChem (CID 170184304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).