C14H22FN — CID 170184385
1,3-ditert-butyl-5-fluoro-2-methylidenepyridine (PubChem CID 170184385) has the molecular formula C14H22FN and a molecular weight of 223.33 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-fluoro-2-methylidenepyridine.
| Compound Name | 1,3-ditert-butyl-5-fluoro-2-methylidenepyridine |
|---|---|
| PubChem CID | 170184385 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1,3-ditert-butyl-5-fluoro-2-methylidenepyridine |
| SMILES | C=C1C(C(C)(C)C)=CC(F)=CN1C(C)(C)C |
| InChI | InChI=1S/C14H22FN/c1-10-12(13(2,3)4)8-11(15)9-16(10)14(5,6)7/h8-9H,1H2,2-7H3 |
| InChIKey | VDNHQUOCJCTAOO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |