C28H42N2 — CID 170184549
(2E,7Z,10Z)-5-ethenyl-10-N,5-dimethyl-9-methylidene-7-[(Z)-prop-1-enyl]-2-N-[(3E)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]dodeca-2,7,10-triene-2,10-diamine (PubChem CID 170184549) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is (2E,7Z,10Z)-5-ethenyl-10-N,5-dimethyl-9-methylidene-7-[(Z)-prop-1-enyl]-2-N-[(3E)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]dodeca-2,7,10-triene-2,10-diamine.
| Compound Name | (2E,7Z,10Z)-5-ethenyl-10-N,5-dimethyl-9-methylidene-7-[(Z)-prop-1-enyl]-2-N-[(3E)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]dodeca-2,7,10-triene-2,10-diamine |
|---|---|
| PubChem CID | 170184549 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (2E,7Z,10Z)-5-ethenyl-10-N,5-dimethyl-9-methylidene-7-[(Z)-prop-1-enyl]-2-N-[(3E)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]dodeca-2,7,10-triene-2,10-diamine |
| SMILES | C=CC(C)(C/C=C(\C)NC(=C)/C(=C/C)C(=C)C)CC(/C=C\C)=C/C(=C)/C(=C/C)NC |
| InChI | InChI=1S/C28H42N2/c1-12-16-25(19-22(7)27(14-3)29-11)20-28(10,15-4)18-17-23(8)30-24(9)26(13-2)21(5)6/h12-17,19,29-30H,4-5,7,9,18,20H2,1-3,6,8,10-11H3/b16-12-,23-17+,25-19+,26-13+,27-14- |
| InChIKey | ZOKVOIKCWPBWLH-LHDXSXCESA-N |
| XLogP | 7.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|