C12H21IN2 — CID 170184622
8-(2-iodopropan-2-yl)-3-prop-1-en-2-yl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170184622) has the molecular formula C12H21IN2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 8-(2-iodopropan-2-yl)-3-prop-1-en-2-yl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 8-(2-iodopropan-2-yl)-3-prop-1-en-2-yl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170184622 |
| Molecular Formula | C12H21IN2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 8-(2-iodopropan-2-yl)-3-prop-1-en-2-yl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | C=C(C)N1CC2CCC(C1)N2C(C)(C)I |
| InChI | InChI=1S/C12H21IN2/c1-9(2)14-7-10-5-6-11(8-14)15(10)12(3,4)13/h10-11H,1,5-8H2,2-4H3 |
| InChIKey | BMEYRSIKHNXKOW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|