C19H24N6OS — CID 170184626
[4-methyl-1-[3-(4-methylsulfanyloxyphenyl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]piperidin-4-yl]methanamine (PubChem CID 170184626) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is [4-methyl-1-[3-(4-methylsulfanyloxyphenyl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]piperidin-4-yl]methanamine.
| Compound Name | [4-methyl-1-[3-(4-methylsulfanyloxyphenyl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 170184626 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [4-methyl-1-[3-(4-methylsulfanyloxyphenyl)-2H-pyrazolo[3,4-b]pyrazin-6-yl]piperidin-4-yl]methanamine |
| SMILES | CSOc1ccc(-c2[nH]nc3nc(N4CCC(C)(CN)CC4)cnc23)cc1 |
| InChI | InChI=1S/C19H24N6OS/c1-19(12-20)7-9-25(10-8-19)15-11-21-17-16(23-24-18(17)22-15)13-3-5-14(6-4-13)26-27-2/h3-6,11H,7-10,12,20H2,1-2H3,(H,22,23,24) |
| InChIKey | GPVWLSHHXDAKBK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|