About [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine
[5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine (PubChem CID 170184656) has the molecular formula C14H15F2N3
and a molecular weight of 263.29 g/mol. Its IUPAC name is [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine |
| PubChem CID | 170184656 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine |
| SMILES | Cc1ccc(-c2nc(NN)ccc2C(C)(F)F)cc1 |
| InChI | InChI=1S/C14H15F2N3/c1-9-3-5-10(6-4-9)13-11(14(2,15)16)7-8-12(18-13)19-17/h3-8H,17H2,1-2H3,(H,18,19) |
| InChIKey | XWGZEYIIGXKZQK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine?
The IUPAC name of [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine (CID 170184656) is [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine?
The canonical SMILES for [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine is Cc1ccc(-c2nc(NN)ccc2C(C)(F)F)cc1.
What is the InChIKey of [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine?
The InChIKey is XWGZEYIIGXKZQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3/c1-9-3-5-10(6-4-9)13-11(14(2,15)16)7-8-12(18-13)19-17/h3-8H,17H2,1-2H3,(H,18,19).
What are the key properties of [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine?
[5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine has a molecular weight of 263.29 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,1-difluoroethyl)-6-(4-methylphenyl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 170184656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).