About N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide
N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide (PubChem CID 170184807) has the molecular formula C17H32F2N2O
and a molecular weight of 318.45 g/mol. Its IUPAC name is N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide |
| PubChem CID | 170184807 |
| Molecular Formula | C17H32F2N2O |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide |
| SMILES | CC(C)CCN1CCC(C(F)(F)CN(C)C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C17H32F2N2O/c1-13(2)6-9-21-10-7-15(8-11-21)17(18,19)12-20(5)16(22)14(3)4/h13-15H,6-12H2,1-5H3 |
| InChIKey | ORADJZWXLSZIRX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide?
The IUPAC name of N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide (CID 170184807) is N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide.
What is the SMILES notation for N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide?
The canonical SMILES for N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide is CC(C)CCN1CCC(C(F)(F)CN(C)C(=O)C(C)C)CC1.
What is the InChIKey of N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide?
The InChIKey is ORADJZWXLSZIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32F2N2O/c1-13(2)6-9-21-10-7-15(8-11-21)17(18,19)12-20(5)16(22)14(3)4/h13-15H,6-12H2,1-5H3.
What are the key properties of N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide?
N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide has a molecular weight of 318.45 g/mol, XLogP of 3.49, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-difluoro-2-[1-(3-methylbutyl)piperidin-4-yl]ethyl]-N,2-dimethylpropanamide is sourced from PubChem (CID 170184807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).