C15H16F2N2O3 — CID 170185524
(3R)-3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 170185524) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is (3R)-3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170185524 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3R)-3-[2,6-difluoro-4-[3-(hydroxymethyl)azetidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2c(F)cc(N3CC(CO)C3)cc2F)C(=O)N1 |
| InChI | InChI=1S/C15H16F2N2O3/c16-11-3-9(19-5-8(6-19)7-20)4-12(17)14(11)10-1-2-13(21)18-15(10)22/h3-4,8,10,20H,1-2,5-7H2,(H,18,21,22)/t10-/m1/s1 |
| InChIKey | NNWGGPWDAGWZAT-SNVBAGLBSA-N |
| XLogP | 0.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|