About 5-fluoro-N,3-dimethylcyclohexen-1-amine
5-fluoro-N,3-dimethylcyclohexen-1-amine (PubChem CID 170185936) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is 5-fluoro-N,3-dimethylcyclohexen-1-amine.
Molecular Properties
| Compound Name | 5-fluoro-N,3-dimethylcyclohexen-1-amine |
| PubChem CID | 170185936 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-fluoro-N,3-dimethylcyclohexen-1-amine |
| SMILES | CNC1=CC(C)CC(F)C1 |
| InChI | InChI=1S/C8H14FN/c1-6-3-7(9)5-8(4-6)10-2/h4,6-7,10H,3,5H2,1-2H3 |
| InChIKey | KWTYFRQVTUNZTK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-N,3-dimethylcyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,3-dimethylcyclohexen-1-amine?
The IUPAC name of 5-fluoro-N,3-dimethylcyclohexen-1-amine (CID 170185936) is 5-fluoro-N,3-dimethylcyclohexen-1-amine.
What is the SMILES notation for 5-fluoro-N,3-dimethylcyclohexen-1-amine?
The canonical SMILES for 5-fluoro-N,3-dimethylcyclohexen-1-amine is CNC1=CC(C)CC(F)C1.
What is the InChIKey of 5-fluoro-N,3-dimethylcyclohexen-1-amine?
The InChIKey is KWTYFRQVTUNZTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14FN/c1-6-3-7(9)5-8(4-6)10-2/h4,6-7,10H,3,5H2,1-2H3.
What are the key properties of 5-fluoro-N,3-dimethylcyclohexen-1-amine?
5-fluoro-N,3-dimethylcyclohexen-1-amine has a molecular weight of 143.20 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,3-dimethylcyclohexen-1-amine is sourced from PubChem (CID 170185936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).