About 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one
2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 170186114) has the molecular formula C11H15N5O2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 170186114 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCOCCNc1nc(N)nc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C11H15N5O2/c1-2-18-6-5-13-9-8-7(15-11(12)16-9)3-4-14-10(8)17/h3-4H,2,5-6H2,1H3,(H,14,17)(H3,12,13,15,16) |
| InChIKey | ZQYQNLYYPVLUNF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one (CID 170186114) is 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one is CCOCCNc1nc(N)nc2cc[nH]c(=O)c12.
What is the InChIKey of 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one?
The InChIKey is ZQYQNLYYPVLUNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O2/c1-2-18-6-5-13-9-8-7(15-11(12)16-9)3-4-14-10(8)17/h3-4H,2,5-6H2,1H3,(H,14,17)(H3,12,13,15,16).
What are the key properties of 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one?
2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one has a molecular weight of 249.27 g/mol, XLogP of 0.35, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2-ethoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 170186114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).