C23H13N3O6 — CID 17018727
6-[3-(2-acetyl-1,3-dioxoisoindol-5-yl)oxyphenyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 17018727) has the molecular formula C23H13N3O6 and a molecular weight of 427.37 g/mol. Its IUPAC name is 6-[3-(2-acetyl-1,3-dioxoisoindol-5-yl)oxyphenyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[3-(2-acetyl-1,3-dioxoisoindol-5-yl)oxyphenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 17018727 |
| Molecular Formula | C23H13N3O6 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 6-[3-(2-acetyl-1,3-dioxoisoindol-5-yl)oxyphenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CC(=O)N1C(=O)c2ccc(Oc3cccc(N4C(=O)c5cccnc5C4=O)c3)cc2C1=O |
| InChI | InChI=1S/C23H13N3O6/c1-12(27)25-20(28)16-8-7-15(11-18(16)22(25)30)32-14-5-2-4-13(10-14)26-21(29)17-6-3-9-24-19(17)23(26)31/h2-11H,1H3 |
| InChIKey | BHLNKDVFGVJWAS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|