About 3-(2-tert-butylphenyl)-N,N-dimethylaniline
3-(2-tert-butylphenyl)-N,N-dimethylaniline (PubChem CID 170187811) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-(2-tert-butylphenyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-(2-tert-butylphenyl)-N,N-dimethylaniline |
| PubChem CID | 170187811 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-(2-tert-butylphenyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C18H23N/c1-18(2,3)17-12-7-6-11-16(17)14-9-8-10-15(13-14)19(4)5/h6-13H,1-5H3 |
| InChIKey | ZQOBZLYHTLYRSN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-tert-butylphenyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-tert-butylphenyl)-N,N-dimethylaniline?
The IUPAC name of 3-(2-tert-butylphenyl)-N,N-dimethylaniline (CID 170187811) is 3-(2-tert-butylphenyl)-N,N-dimethylaniline.
What is the SMILES notation for 3-(2-tert-butylphenyl)-N,N-dimethylaniline?
The canonical SMILES for 3-(2-tert-butylphenyl)-N,N-dimethylaniline is CN(C)c1cccc(-c2ccccc2C(C)(C)C)c1.
What is the InChIKey of 3-(2-tert-butylphenyl)-N,N-dimethylaniline?
The InChIKey is ZQOBZLYHTLYRSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N/c1-18(2,3)17-12-7-6-11-16(17)14-9-8-10-15(13-14)19(4)5/h6-13H,1-5H3.
What are the key properties of 3-(2-tert-butylphenyl)-N,N-dimethylaniline?
3-(2-tert-butylphenyl)-N,N-dimethylaniline has a molecular weight of 253.39 g/mol, XLogP of 4.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-tert-butylphenyl)-N,N-dimethylaniline is sourced from PubChem (CID 170187811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).